Which one of the following reactions does not come under hydrolysis type reaction?

Which one of the following reactions does not come under hydrolysis type reaction?
  1. SiCl4(l)+2H2O(l)SiO2(s)+4HCl(aq)
  2. Li3N(s)+3H2OlNH3(g)+3LiOH(aq)
  3. 2F2(g)+2H2Ol4HF(aq)+O2(g)
  4. P4O10(s)+6H2Ol4H3PO4(aq)

Solution

2F2(g)+2H2O()4HF(aq)+O2(g)
It's a type of Redox reaction.

Asked in: NEET 2020 (Phase 2)

Practice more Redox Reactions questions on Aicharya