Choose the correct statement(s) among the following.

Choose the correct statement(s) among the following.
  1. SnCl2·2H2O is a reducing agent.
  2. SnO2 reacts with KOH to form K2Sn(OH)6
  3. A solution of PbCl2 in HCl contains Pb2+and Cl- ions.
  4. The reaction of Pb3O4 with hot dilute nitric acid to give PbO2 is a redox reaction.

Solution

(A) Sn2+ is a good reducing agent which gets oxidise into Sn4+

(B) Amphoteric nature.

(C) PbCl2+2Cl-PbCl42-

(D) Pb3O4(2PbO+PbO2)+4HNO3(Conc.)PbO2+2PbNO32+6H2O

Asked in: JEE Advanced 2020 (Paper 2)

Practice more Redox Reactions questions on Aicharya